C13H21N3O2 — CID 168719757
ethyl 2-[(4,6-diethylpyrimidin-2-yl)-methylamino]acetate (PubChem CID 168719757) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is ethyl 2-[(4,6-diethylpyrimidin-2-yl)-methylamino]acetate.
| Compound Name | ethyl 2-[(4,6-diethylpyrimidin-2-yl)-methylamino]acetate |
|---|---|
| PubChem CID | 168719757 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | ethyl 2-[(4,6-diethylpyrimidin-2-yl)-methylamino]acetate |
| SMILES | CCOC(=O)CN(C)c1nc(CC)cc(CC)n1 |
| InChI | InChI=1S/C13H21N3O2/c1-5-10-8-11(6-2)15-13(14-10)16(4)9-12(17)18-7-3/h8H,5-7,9H2,1-4H3 |
| InChIKey | MVDCBXIEQXAEDI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |