C27H23F13Si — CID 168720153
dimethyl-[naphthalen-2-yl(phenyl)methyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane (PubChem CID 168720153) has the molecular formula C27H23F13Si and a molecular weight of 622.54 g/mol. Its IUPAC name is dimethyl-[naphthalen-2-yl(phenyl)methyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane.
| Compound Name | dimethyl-[naphthalen-2-yl(phenyl)methyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
|---|---|
| PubChem CID | 168720153 |
| Molecular Formula | C27H23F13Si |
| Molecular Weight | 622.54 g/mol |
| Exact Mass | 622.14 |
| IUPAC Name | dimethyl-[naphthalen-2-yl(phenyl)methyl]-(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)silane |
| SMILES | C[Si](C)(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(c1ccccc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C27H23F13Si/c1-41(2,21(18-9-4-3-5-10-18)20-13-12-17-8-6-7-11-19(17)16-20)15-14-22(28,29)23(30,31)24(32,33)25(34,35)26(36,37)27(38,39)40/h3-13,16,21H,14-15H2,1-2H3 |
| InChIKey | HPJOVGHYYPFRGA-UHFFFAOYSA-N |
| XLogP | 10.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.54 |
| LogP ≤ 5 | 10.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|