C46H41N5OSi — CID 168720951
6-tert-butyl-12-[5-(4-tert-butyl-2-pyridinyl)pyrido[4,3-b]indol-3-yl]oxy-8,8-diphenyl-3,10-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 168720951) has the molecular formula C46H41N5OSi and a molecular weight of 707.95 g/mol. Its IUPAC name is 6-tert-butyl-12-[5-(4-tert-butyl-2-pyridinyl)pyrido[4,3-b]indol-3-yl]oxy-8,8-diphenyl-3,10-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 6-tert-butyl-12-[5-(4-tert-butyl-2-pyridinyl)pyrido[4,3-b]indol-3-yl]oxy-8,8-diphenyl-3,10-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 168720951 |
| Molecular Formula | C46H41N5OSi |
| Molecular Weight | 707.95 g/mol |
| Exact Mass | 707.31 |
| IUPAC Name | 6-tert-butyl-12-[5-(4-tert-butyl-2-pyridinyl)pyrido[4,3-b]indol-3-yl]oxy-8,8-diphenyl-3,10-diaza-8-silatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | CC(C)(C)c1ccnc(-n2c3ccccc3c3cnc(Oc4cnc5c(c4)-c4nccc(C(C)(C)C)c4[Si]5(c4ccccc4)c4ccccc4)cc32)c1 |
| InChI | InChI=1S/C46H41N5OSi/c1-45(2,3)30-21-23-47-40(25-30)51-38-20-14-13-19-34(38)36-29-49-41(27-39(36)51)52-31-26-35-42-43(37(22-24-48-42)46(4,5)6)53(44(35)50-28-31,32-15-9-7-10-16-32)33-17-11-8-12-18-33/h7-29H,1-6H3 |
| InChIKey | AYUDOOSKFQISGU-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.95 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|