C49H40N4OPtSi — CID 168721112
4-tert-butyl-8-[[9-(4-tert-butyl-2-pyridinyl)-6-isocyano-1H-carbazol-1-id-2-yl]oxy]-5,5-diphenyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;platinum(2+) (PubChem CID 168721112) has the molecular formula C49H40N4OPtSi and a molecular weight of 924.05 g/mol. Its IUPAC name is 4-tert-butyl-8-[[9-(4-tert-butyl-2-pyridinyl)-6-isocyano-1H-carbazol-1-id-2-yl]oxy]-5,5-diphenyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;platinum(2+).
| Compound Name | 4-tert-butyl-8-[[9-(4-tert-butyl-2-pyridinyl)-6-isocyano-1H-carbazol-1-id-2-yl]oxy]-5,5-diphenyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;platinum(2+) |
|---|---|
| PubChem CID | 168721112 |
| Molecular Formula | C49H40N4OPtSi |
| Molecular Weight | 924.05 g/mol |
| Exact Mass | 923.26 |
| IUPAC Name | 4-tert-butyl-8-[[9-(4-tert-butyl-2-pyridinyl)-6-isocyano-1H-carbazol-1-id-2-yl]oxy]-5,5-diphenyl-9H-[1]benzosilolo[3,2-b]pyridin-9-ide;platinum(2+) |
| SMILES | [C-]#[N+]c1ccc2c(c1)c1ccc(Oc3[c-]c4c(cc3)[Si](c3ccccc3)(c3ccccc3)c3c(C(C)(C)C)ccnc3-4)[c-]c1n2-c1cc(C(C)(C)C)ccn1.[Pt+2] |
| InChI | InChI=1S/C49H40N4OSi.Pt/c1-48(2,3)32-24-26-51-45(28-32)53-42-22-18-33(50-7)29-39(42)38-21-19-35(31-43(38)53)54-34-20-23-44-40(30-34)46-47(41(25-27-52-46)49(4,5)6)55(44,36-14-10-8-11-15-36)37-16-12-9-13-17-37;/h8-29H,1-6H3;/q-2;+2 |
| InChIKey | HSZYAVZIUOZCPK-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 44.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 924.05 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|