C43H39GeN4OPt+ — CID 168743709
[9-(4-tert-butyl-2-pyridinyl)-7-[3-(3-phenylbenzimidazol-3-ium-1-yl)benzene-2-id-1-yl]oxy-8H-carbazol-8-id-3-yl]-trimethylgermane;platinum(2+) (PubChem CID 168743709) has the molecular formula C43H39GeN4OPt+ and a molecular weight of 895.50 g/mol. Its IUPAC name is [9-(4-tert-butyl-2-pyridinyl)-7-[3-(3-phenylbenzimidazol-3-ium-1-yl)benzene-2-id-1-yl]oxy-8H-carbazol-8-id-3-yl]-trimethylgermane;platinum(2+).
| Compound Name | [9-(4-tert-butyl-2-pyridinyl)-7-[3-(3-phenylbenzimidazol-3-ium-1-yl)benzene-2-id-1-yl]oxy-8H-carbazol-8-id-3-yl]-trimethylgermane;platinum(2+) |
|---|---|
| PubChem CID | 168743709 |
| Molecular Formula | C43H39GeN4OPt+ |
| Molecular Weight | 895.50 g/mol |
| Exact Mass | 896.20 |
| IUPAC Name | [9-(4-tert-butyl-2-pyridinyl)-7-[3-(3-phenylbenzimidazol-3-ium-1-yl)benzene-2-id-1-yl]oxy-8H-carbazol-8-id-3-yl]-trimethylgermane;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-n2c3[c-]c(Oc4[c-]c(-n5c[n+](-c6ccccc6)c6ccccc65)ccc4)ccc3c3cc([Ge](C)(C)C)ccc32)c1.[Pt+2] |
| InChI | InChI=1S/C43H39GeN4O.Pt/c1-43(2,3)30-23-24-45-42(25-30)48-38-22-19-31(44(4,5)6)26-37(38)36-21-20-35(28-41(36)48)49-34-16-12-15-33(27-34)47-29-46(32-13-8-7-9-14-32)39-17-10-11-18-40(39)47;/h7-26,29H,1-6H3;/q-1;+2 |
| InChIKey | HEWRMAIAJYUMHT-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 895.50 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|