C40H36N2OS — CID 168721248
8-[3-tert-butyl-5-(4-tert-butyl-2-pyridinyl)phenoxy]-15-phenyl-17-thia-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene (PubChem CID 168721248) has the molecular formula C40H36N2OS and a molecular weight of 592.81 g/mol. Its IUPAC name is 8-[3-tert-butyl-5-(4-tert-butyl-2-pyridinyl)phenoxy]-15-phenyl-17-thia-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene.
| Compound Name | 8-[3-tert-butyl-5-(4-tert-butyl-2-pyridinyl)phenoxy]-15-phenyl-17-thia-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
|---|---|
| PubChem CID | 168721248 |
| Molecular Formula | C40H36N2OS |
| Molecular Weight | 592.81 g/mol |
| Exact Mass | 592.25 |
| IUPAC Name | 8-[3-tert-butyl-5-(4-tert-butyl-2-pyridinyl)phenoxy]-15-phenyl-17-thia-12-azatetracyclo[8.7.0.02,7.011,16]heptadeca-1(10),2,4,6,8,11,13,15-octaene |
| SMILES | CC(C)(C)c1cc(Oc2cc3c4nccc(-c5ccccc5)c4sc3c3ccccc23)cc(-c2cc(C(C)(C)C)ccn2)c1 |
| InChI | InChI=1S/C40H36N2OS/c1-39(2,3)27-16-18-41-34(23-27)26-20-28(40(4,5)6)22-29(21-26)43-35-24-33-36-38(44-37(33)32-15-11-10-14-31(32)35)30(17-19-42-36)25-12-8-7-9-13-25/h7-24H,1-6H3 |
| InChIKey | JASSQQFYWKGADE-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.81 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |