About CID 168724004
CID 168724004 (PubChem CID 168724004) has the molecular formula C9H17OS
and a molecular weight of 173.30 g/mol.
Molecular Properties
| Compound Name | CID 168724004 |
| PubChem CID | 168724004 |
| Molecular Formula | C9H17OS |
| Molecular Weight | 173.30 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | — |
| SMILES | [CH2]C(C)(C)C(=S)OC(C)(C)C |
| InChI | InChI=1S/C9H17OS/c1-8(2,3)7(11)10-9(4,5)6/h1H2,2-6H3 |
| InChIKey | VCOUDHKOTVQJFW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.30 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze CID 168724004 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168724004?
The IUPAC name of CID 168724004 (CID 168724004) is not available.
What is the SMILES notation for CID 168724004?
The canonical SMILES for CID 168724004 is [CH2]C(C)(C)C(=S)OC(C)(C)C.
What is the InChIKey of CID 168724004?
The InChIKey is VCOUDHKOTVQJFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17OS/c1-8(2,3)7(11)10-9(4,5)6/h1H2,2-6H3.
What are the key properties of CID 168724004?
CID 168724004 has a molecular weight of 173.30 g/mol, XLogP of 2.99, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168724004 is sourced from PubChem (CID 168724004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).