C10H18Cl2O2 — CID 134895292
2-[(Z)-1,2-dichloro-2-[(2-methylpropan-2-yl)oxy]ethenoxy]-2-methylpropane (PubChem CID 134895292) has the molecular formula C10H18Cl2O2 and a molecular weight of 241.16 g/mol. Its IUPAC name is 2-[(Z)-1,2-dichloro-2-[(2-methylpropan-2-yl)oxy]ethenoxy]-2-methylpropane.
| Compound Name | 2-[(Z)-1,2-dichloro-2-[(2-methylpropan-2-yl)oxy]ethenoxy]-2-methylpropane |
|---|---|
| PubChem CID | 134895292 |
| Molecular Formula | C10H18Cl2O2 |
| Molecular Weight | 241.16 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2-[(Z)-1,2-dichloro-2-[(2-methylpropan-2-yl)oxy]ethenoxy]-2-methylpropane |
| SMILES | CC(C)(C)O/C(Cl)=C(/Cl)OC(C)(C)C |
| InChI | InChI=1S/C10H18Cl2O2/c1-9(2,3)13-7(11)8(12)14-10(4,5)6/h1-6H3/b8-7- |
| InChIKey | MDTCVSASBNSWHH-FPLPWBNLSA-N |
| XLogP | 4.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.16 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|