C12H16N2 — CID 168725075
2,7-dimethyl-6-propan-2-ylindazole (PubChem CID 168725075) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2,7-dimethyl-6-propan-2-ylindazole.
| Compound Name | 2,7-dimethyl-6-propan-2-ylindazole |
|---|---|
| PubChem CID | 168725075 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 2,7-dimethyl-6-propan-2-ylindazole |
| SMILES | Cc1c(C(C)C)ccc2cn(C)nc12 |
| InChI | InChI=1S/C12H16N2/c1-8(2)11-6-5-10-7-14(4)13-12(10)9(11)3/h5-8H,1-4H3 |
| InChIKey | CMNBTZGCMIIUCU-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |