About 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one
1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one (PubChem CID 168726992) has the molecular formula C17H32N2O
and a molecular weight of 280.46 g/mol. Its IUPAC name is 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one |
| PubChem CID | 168726992 |
| Molecular Formula | C17H32N2O |
| Molecular Weight | 280.46 g/mol |
| Exact Mass | 280.25 |
| IUPAC Name | 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one |
| SMILES | CC(C)(C)CC(=O)N1CC2(CCCN(C(C)(C)C)C2)C1 |
| InChI | InChI=1S/C17H32N2O/c1-15(2,3)10-14(20)18-11-17(12-18)8-7-9-19(13-17)16(4,5)6/h7-13H2,1-6H3 |
| InChIKey | USPPEEYLDODWGK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one?
The IUPAC name of 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one (CID 168726992) is 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one.
What is the SMILES notation for 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one?
The canonical SMILES for 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one is CC(C)(C)CC(=O)N1CC2(CCCN(C(C)(C)C)C2)C1.
What is the InChIKey of 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one?
The InChIKey is USPPEEYLDODWGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H32N2O/c1-15(2,3)10-14(20)18-11-17(12-18)8-7-9-19(13-17)16(4,5)6/h7-13H2,1-6H3.
What are the key properties of 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one?
1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one has a molecular weight of 280.46 g/mol, XLogP of 3.15, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-tert-butyl-2,8-diazaspiro[3.5]nonan-2-yl)-3,3-dimethylbutan-1-one is sourced from PubChem (CID 168726992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).