C25H26N4O — CID 168730582
2-[6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-N-(2-methylpropyl)anilino]-2-pyridinyl]phenol (PubChem CID 168730582) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 2-[6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-N-(2-methylpropyl)anilino]-2-pyridinyl]phenol.
| Compound Name | 2-[6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-N-(2-methylpropyl)anilino]-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 168730582 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 2-[6-[3-(3-methyl-2H-imidazol-3-ium-2-id-1-yl)-N-(2-methylpropyl)anilino]-2-pyridinyl]phenol |
| SMILES | CC(C)CN(c1cccc(-n2[c-][n+](C)cc2)c1)c1cccc(-c2ccccc2O)n1 |
| InChI | InChI=1S/C25H26N4O/c1-19(2)17-29(21-9-6-8-20(16-21)28-15-14-27(3)18-28)25-13-7-11-23(26-25)22-10-4-5-12-24(22)30/h4-16,19,30H,17H2,1-3H3 |
| InChIKey | TXZLFEZHMNYTLG-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 45.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|