C22H30N8O2S — CID 168731046
tert-butyl N-[3-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-2-yl)methylidene]carbamothioyl]amino]pyrazin-2-yl]-N-methylcarbamate (PubChem CID 168731046) has the molecular formula C22H30N8O2S and a molecular weight of 470.60 g/mol. Its IUPAC name is tert-butyl N-[3-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-2-yl)methylidene]carbamothioyl]amino]pyrazin-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[3-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-2-yl)methylidene]carbamothioyl]amino]pyrazin-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 168731046 |
| Molecular Formula | C22H30N8O2S |
| Molecular Weight | 470.60 g/mol |
| Exact Mass | 470.22 |
| IUPAC Name | tert-butyl N-[3-[[(Z)-[amino-(1-propan-2-yl-2,3-dihydropyrrolo[2,3-c]pyridin-2-yl)methylidene]carbamothioyl]amino]pyrazin-2-yl]-N-methylcarbamate |
| SMILES | CC(C)N1c2cnccc2CC1/C(N)=N/C(=S)Nc1nccnc1N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H30N8O2S/c1-13(2)30-15(11-14-7-8-24-12-16(14)30)17(23)27-20(33)28-18-19(26-10-9-25-18)29(6)21(31)32-22(3,4)5/h7-10,12-13,15H,11H2,1-6H3,(H3,23,25,27,28,33) |
| InChIKey | OUFNOKLBZBBZGU-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 121.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|