C22H27F3N6O3S — CID 172799357
tert-butyl N-[6-[[amino-(4-propan-2-yloxy-2-pyridinyl)methylidene]carbamothioylamino]-5-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate (PubChem CID 172799357) has the molecular formula C22H27F3N6O3S and a molecular weight of 512.56 g/mol. Its IUPAC name is tert-butyl N-[6-[[amino-(4-propan-2-yloxy-2-pyridinyl)methylidene]carbamothioylamino]-5-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[6-[[amino-(4-propan-2-yloxy-2-pyridinyl)methylidene]carbamothioylamino]-5-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 172799357 |
| Molecular Formula | C22H27F3N6O3S |
| Molecular Weight | 512.56 g/mol |
| Exact Mass | 512.18 |
| IUPAC Name | tert-butyl N-[6-[[amino-(4-propan-2-yloxy-2-pyridinyl)methylidene]carbamothioylamino]-5-(trifluoromethyl)-3-pyridinyl]-N-methylcarbamate |
| SMILES | CC(C)Oc1ccnc(C(N)=NC(=S)Nc2ncc(N(C)C(=O)OC(C)(C)C)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C22H27F3N6O3S/c1-12(2)33-14-7-8-27-16(10-14)17(26)29-19(35)30-18-15(22(23,24)25)9-13(11-28-18)31(6)20(32)34-21(3,4)5/h7-12H,1-6H3,(H3,26,28,29,30,35) |
| InChIKey | QQLNCLILDCIGOT-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 114.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.56 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|