C16H16F3N5S — CID 172764645
1-[amino-(4-propan-2-yl-2-pyridinyl)methylidene]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea (PubChem CID 172764645) has the molecular formula C16H16F3N5S and a molecular weight of 367.40 g/mol. Its IUPAC name is 1-[amino-(4-propan-2-yl-2-pyridinyl)methylidene]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea.
| Compound Name | 1-[amino-(4-propan-2-yl-2-pyridinyl)methylidene]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 172764645 |
| Molecular Formula | C16H16F3N5S |
| Molecular Weight | 367.40 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 1-[amino-(4-propan-2-yl-2-pyridinyl)methylidene]-3-[3-(trifluoromethyl)-2-pyridinyl]thiourea |
| SMILES | CC(C)c1ccnc(C(N)=NC(=S)Nc2ncccc2C(F)(F)F)c1 |
| InChI | InChI=1S/C16H16F3N5S/c1-9(2)10-5-7-21-12(8-10)13(20)23-15(25)24-14-11(16(17,18)19)4-3-6-22-14/h3-9H,1-2H3,(H3,20,22,23,24,25) |
| InChIKey | MDMXHSLLISAFMF-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.40 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|