C18H21F3N6OS — CID 155230636
(1Z)-1-[amino-[5-propan-2-yloxy-4-(trifluoromethyl)-2-pyridinyl]methylidene]-3-[3-(dimethylamino)-2-pyridinyl]thiourea (PubChem CID 155230636) has the molecular formula C18H21F3N6OS and a molecular weight of 426.47 g/mol. Its IUPAC name is (1Z)-1-[amino-[5-propan-2-yloxy-4-(trifluoromethyl)-2-pyridinyl]methylidene]-3-[3-(dimethylamino)-2-pyridinyl]thiourea.
| Compound Name | (1Z)-1-[amino-[5-propan-2-yloxy-4-(trifluoromethyl)-2-pyridinyl]methylidene]-3-[3-(dimethylamino)-2-pyridinyl]thiourea |
|---|---|
| PubChem CID | 155230636 |
| Molecular Formula | C18H21F3N6OS |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | (1Z)-1-[amino-[5-propan-2-yloxy-4-(trifluoromethyl)-2-pyridinyl]methylidene]-3-[3-(dimethylamino)-2-pyridinyl]thiourea |
| SMILES | CC(C)Oc1cnc(/C(N)=N/C(=S)Nc2ncccc2N(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C18H21F3N6OS/c1-10(2)28-14-9-24-12(8-11(14)18(19,20)21)15(22)25-17(29)26-16-13(27(3)4)6-5-7-23-16/h5-10H,1-4H3,(H3,22,23,25,26,29) |
| InChIKey | RVZPSESOPTVJSX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 88.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|