C18H18F3N5O3S — CID 155632112
methyl 2-[[5-(1-iminopropan-2-yloxy)-4-(trifluoromethyl)-2-pyridinyl]methylcarbamothioylamino]pyridine-3-carboxylate (PubChem CID 155632112) has the molecular formula C18H18F3N5O3S and a molecular weight of 441.44 g/mol. Its IUPAC name is methyl 2-[[5-(1-iminopropan-2-yloxy)-4-(trifluoromethyl)-2-pyridinyl]methylcarbamothioylamino]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[5-(1-iminopropan-2-yloxy)-4-(trifluoromethyl)-2-pyridinyl]methylcarbamothioylamino]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 155632112 |
| Molecular Formula | C18H18F3N5O3S |
| Molecular Weight | 441.44 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | methyl 2-[[5-(1-iminopropan-2-yloxy)-4-(trifluoromethyl)-2-pyridinyl]methylcarbamothioylamino]pyridine-3-carboxylate |
| SMILES | [H]/N=C/C(C)Oc1cnc(CNC(=S)Nc2ncccc2C(=O)OC)cc1C(F)(F)F |
| InChI | InChI=1S/C18H18F3N5O3S/c1-10(7-22)29-14-9-24-11(6-13(14)18(19,20)21)8-25-17(30)26-15-12(16(27)28-2)4-3-5-23-15/h3-7,9-10,22H,8H2,1-2H3,(H2,23,25,26,30)/b22-7+ |
| InChIKey | KLNGAZZXWDNRKK-QPJQQBGISA-N |
| XLogP | 3.19 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.44 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|