C41H41F3IrNO3S- — CID 168736814
7-(1-benzofuran-2-yl)-1-(3,5-dimethylbenzene-6-id-1-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium (PubChem CID 168736814) has the molecular formula C41H41F3IrNO3S- and a molecular weight of 877.06 g/mol. Its IUPAC name is 7-(1-benzofuran-2-yl)-1-(3,5-dimethylbenzene-6-id-1-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium.
| Compound Name | 7-(1-benzofuran-2-yl)-1-(3,5-dimethylbenzene-6-id-1-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
|---|---|
| PubChem CID | 168736814 |
| Molecular Formula | C41H41F3IrNO3S- |
| Molecular Weight | 877.06 g/mol |
| Exact Mass | 877.24 |
| IUPAC Name | 7-(1-benzofuran-2-yl)-1-(3,5-dimethylbenzene-6-id-1-yl)-8-(trifluoromethyl)-[1]benzothiolo[2,3-c]pyridine;(Z)-3,7-diethyl-6-hydroxynon-5-en-4-one;iridium |
| SMILES | CCC(CC)C(=O)/C=C(\O)C(CC)CC.Cc1[c-]c(-c2nccc3c2sc2c(C(F)(F)F)c(-c4cc5ccccc5o4)ccc23)cc(C)c1.[Ir] |
| InChI | InChI=1S/C28H17F3NOS.C13H24O2.Ir/c1-15-11-16(2)13-18(12-15)25-27-20(9-10-32-25)19-7-8-21(24(26(19)34-27)28(29,30)31)23-14-17-5-3-4-6-22(17)33-23;1-5-10(6-2)12(14)9-13(15)11(7-3)8-4;/h3-12,14H,1-2H3;9-11,14H,5-8H2,1-4H3;/q-1;;/b;12-9-; |
| InChIKey | GDSMJDFNFHBZRP-DZTQYQPZSA-N |
| XLogP | 12.83 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 877.06 |
| LogP ≤ 5 | 12.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|