C15H18O2 — CID 168738456
4-cyclohexyl-5-methylbenzene-1,3-dicarbaldehyde (PubChem CID 168738456) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 4-cyclohexyl-5-methylbenzene-1,3-dicarbaldehyde.
| Compound Name | 4-cyclohexyl-5-methylbenzene-1,3-dicarbaldehyde |
|---|---|
| PubChem CID | 168738456 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 4-cyclohexyl-5-methylbenzene-1,3-dicarbaldehyde |
| SMILES | Cc1cc(C=O)cc(C=O)c1C1CCCCC1 |
| InChI | InChI=1S/C15H18O2/c1-11-7-12(9-16)8-14(10-17)15(11)13-5-3-2-4-6-13/h7-10,13H,2-6H2,1H3 |
| InChIKey | CEUWBZCZCVTMFR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|