C42H26N4Se — CID 168740108
8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-naphthalen-2-ylbenzo[g][1,3]benzoselenazole (PubChem CID 168740108) has the molecular formula C42H26N4Se and a molecular weight of 665.66 g/mol. Its IUPAC name is 8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-naphthalen-2-ylbenzo[g][1,3]benzoselenazole.
| Compound Name | 8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-naphthalen-2-ylbenzo[g][1,3]benzoselenazole |
|---|---|
| PubChem CID | 168740108 |
| Molecular Formula | C42H26N4Se |
| Molecular Weight | 665.66 g/mol |
| Exact Mass | 666.13 |
| IUPAC Name | 8-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-2-naphthalen-2-ylbenzo[g][1,3]benzoselenazole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc(-c4ccc5ccc6nc(-c7ccc8ccccc8c7)[se]c6c5c4)c3)n2)cc1 |
| InChI | InChI=1S/C42H26N4Se/c1-3-11-29(12-4-1)39-44-40(30-13-5-2-6-14-30)46-41(45-39)34-17-9-16-32(24-34)33-20-19-28-22-23-37-38(36(28)26-33)47-42(43-37)35-21-18-27-10-7-8-15-31(27)25-35/h1-26H |
| InChIKey | CGRYTHLBKDMOKI-UHFFFAOYSA-N |
| XLogP | 10.12 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.66 |
| LogP ≤ 5 | 10.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|