C21H20BrClFIN4O3 — CID 168742810
tert-butyl 5-(8-bromo-5-chloro-7-fluoro-9-iodo-3-oxo-2,4-dihydropyrazino[2,3-c]quinolin-1-yl)-2-azabicyclo[2.1.1]hexane-2-carboxylate (PubChem CID 168742810) has the molecular formula C21H20BrClFIN4O3 and a molecular weight of 637.68 g/mol. Its IUPAC name is tert-butyl 5-(8-bromo-5-chloro-7-fluoro-9-iodo-3-oxo-2,4-dihydropyrazino[2,3-c]quinolin-1-yl)-2-azabicyclo[2.1.1]hexane-2-carboxylate.
| Compound Name | tert-butyl 5-(8-bromo-5-chloro-7-fluoro-9-iodo-3-oxo-2,4-dihydropyrazino[2,3-c]quinolin-1-yl)-2-azabicyclo[2.1.1]hexane-2-carboxylate |
|---|---|
| PubChem CID | 168742810 |
| Molecular Formula | C21H20BrClFIN4O3 |
| Molecular Weight | 637.68 g/mol |
| Exact Mass | 635.94 |
| IUPAC Name | tert-butyl 5-(8-bromo-5-chloro-7-fluoro-9-iodo-3-oxo-2,4-dihydropyrazino[2,3-c]quinolin-1-yl)-2-azabicyclo[2.1.1]hexane-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CC1C2N1CC(=O)Nc2c(Cl)nc3c(F)c(Br)c(I)cc3c21 |
| InChI | InChI=1S/C21H20BrClFIN4O3/c1-21(2,3)32-20(31)28-6-8-4-11(28)17(8)29-7-12(30)26-16-18(29)9-5-10(25)13(22)14(24)15(9)27-19(16)23/h5,8,11,17H,4,6-7H2,1-3H3,(H,26,30) |
| InChIKey | XBELUNFAXJKJEX-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.68 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|