C38H36GeN2 — CID 168743401
[6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]triphenylen-2-yl]-trimethylgermane (PubChem CID 168743401) has the molecular formula C38H36GeN2 and a molecular weight of 593.33 g/mol. Its IUPAC name is [6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]triphenylen-2-yl]-trimethylgermane.
| Compound Name | [6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]triphenylen-2-yl]-trimethylgermane |
|---|---|
| PubChem CID | 168743401 |
| Molecular Formula | C38H36GeN2 |
| Molecular Weight | 593.33 g/mol |
| Exact Mass | 594.21 |
| IUPAC Name | [6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]triphenylen-2-yl]-trimethylgermane |
| SMILES | CC(C)(C)c1ccccc1-n1c(-c2ccc3c4ccccc4c4cc([Ge](C)(C)C)ccc4c3c2)nc2ccccc21 |
| InChI | InChI=1S/C38H36GeN2/c1-38(2,3)33-15-9-11-17-35(33)41-36-18-12-10-16-34(36)40-37(41)25-19-21-29-27-13-7-8-14-28(27)32-24-26(39(4,5)6)20-22-30(32)31(29)23-25/h7-24H,1-6H3 |
| InChIKey | KBXANECWYCDLKK-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.33 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|