C50H42F3GeIrN3-2 — CID 168743400
[6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]-7H-triphenylen-7-id-2-yl]-trimethylgermane;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine (PubChem CID 168743400) has the molecular formula C50H42F3GeIrN3-2 and a molecular weight of 1006.73 g/mol. Its IUPAC name is [6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]-7H-triphenylen-7-id-2-yl]-trimethylgermane;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine.
| Compound Name | [6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]-7H-triphenylen-7-id-2-yl]-trimethylgermane;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
|---|---|
| PubChem CID | 168743400 |
| Molecular Formula | C50H42F3GeIrN3-2 |
| Molecular Weight | 1006.73 g/mol |
| Exact Mass | 1008.22 |
| IUPAC Name | [6-[1-(2-tert-butylphenyl)benzimidazol-2-yl]-7H-triphenylen-7-id-2-yl]-trimethylgermane;iridium;2-[4-(trifluoromethyl)benzene-6-id-1-yl]pyridine |
| SMILES | CC(C)(C)c1ccccc1-n1c(-c2[c-]cc3c4ccccc4c4cc([Ge](C)(C)C)ccc4c3c2)nc2ccccc21.FC(F)(F)c1c[c-]c(-c2ccccn2)cc1.[Ir] |
| InChI | InChI=1S/C38H35GeN2.C12H7F3N.Ir/c1-38(2,3)33-15-9-11-17-35(33)41-36-18-12-10-16-34(36)40-37(41)25-19-21-29-27-13-7-8-14-28(27)32-24-26(39(4,5)6)20-22-30(32)31(29)23-25;13-12(14,15)10-6-4-9(5-7-10)11-3-1-2-8-16-11;/h7-18,20-24H,1-6H3;1-4,6-8H;/q2*-1; |
| InChIKey | SVMUCQJJTBYIAS-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1006.73 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|