C41H38N2 — CID 170531895
1-(2,6-ditert-butyl-4-phenylphenyl)-2-phenanthren-3-ylbenzimidazole (PubChem CID 170531895) has the molecular formula C41H38N2 and a molecular weight of 558.77 g/mol. Its IUPAC name is 1-(2,6-ditert-butyl-4-phenylphenyl)-2-phenanthren-3-ylbenzimidazole.
| Compound Name | 1-(2,6-ditert-butyl-4-phenylphenyl)-2-phenanthren-3-ylbenzimidazole |
|---|---|
| PubChem CID | 170531895 |
| Molecular Formula | C41H38N2 |
| Molecular Weight | 558.77 g/mol |
| Exact Mass | 558.30 |
| IUPAC Name | 1-(2,6-ditert-butyl-4-phenylphenyl)-2-phenanthren-3-ylbenzimidazole |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)cc(C(C)(C)C)c1-n1c(-c2ccc3ccc4ccccc4c3c2)nc2ccccc21 |
| InChI | InChI=1S/C41H38N2/c1-40(2,3)34-25-31(27-14-8-7-9-15-27)26-35(41(4,5)6)38(34)43-37-19-13-12-18-36(37)42-39(43)30-23-22-29-21-20-28-16-10-11-17-32(28)33(29)24-30/h7-26H,1-6H3 |
| InChIKey | YHRFWYPBZCHKSJ-UHFFFAOYSA-N |
| XLogP | 11.26 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.77 |
| LogP ≤ 5 | 11.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|