C28H29B3N2 — CID 174005103
CID 174005103 (PubChem CID 174005103) has the molecular formula C28H29B3N2 and a molecular weight of 425.99 g/mol.
| Compound Name | CID 174005103 |
|---|---|
| PubChem CID | 174005103 |
| Molecular Formula | C28H29B3N2 |
| Molecular Weight | 425.99 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | — |
| SMILES | [B]C(C)(C)c1cc(C([B])(C)C)c(-n2c(-c3ccccc3)nc3ccccc32)c(C([B])(C)C)c1 |
| InChI | InChI=1S/C28H29B3N2/c1-26(2,29)19-16-20(27(3,4)30)24(21(17-19)28(5,6)31)33-23-15-11-10-14-22(23)32-25(33)18-12-8-7-9-13-18/h7-17H,1-6H3 |
| InChIKey | SUXUSKOHKPNECX-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|