C47H36N2S — CID 156657496
1-(4-tert-butyl-2,6-diphenylphenyl)-2-(7-phenyldibenzothiophen-2-yl)benzimidazole (PubChem CID 156657496) has the molecular formula C47H36N2S and a molecular weight of 660.89 g/mol. Its IUPAC name is 1-(4-tert-butyl-2,6-diphenylphenyl)-2-(7-phenyldibenzothiophen-2-yl)benzimidazole.
| Compound Name | 1-(4-tert-butyl-2,6-diphenylphenyl)-2-(7-phenyldibenzothiophen-2-yl)benzimidazole |
|---|---|
| PubChem CID | 156657496 |
| Molecular Formula | C47H36N2S |
| Molecular Weight | 660.89 g/mol |
| Exact Mass | 660.26 |
| IUPAC Name | 1-(4-tert-butyl-2,6-diphenylphenyl)-2-(7-phenyldibenzothiophen-2-yl)benzimidazole |
| SMILES | CC(C)(C)c1cc(-c2ccccc2)c(-n2c(-c3ccc4sc5cc(-c6ccccc6)ccc5c4c3)nc3ccccc32)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C47H36N2S/c1-47(2,3)36-29-38(32-17-9-5-10-18-32)45(39(30-36)33-19-11-6-12-20-33)49-42-22-14-13-21-41(42)48-46(49)35-24-26-43-40(27-35)37-25-23-34(28-44(37)50-43)31-15-7-4-8-16-31/h4-30H,1-3H3 |
| InChIKey | NSPVNVBOMSNFFX-UHFFFAOYSA-N |
| XLogP | 13.36 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.89 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |