C57H40GeN4OPt-2 — CID 168743487
CID 168743487 (PubChem CID 168743487) has the molecular formula C57H40GeN4OPt-2 and a molecular weight of 1069.69 g/mol.
| Compound Name | CID 168743487 |
|---|---|
| PubChem CID | 168743487 |
| Molecular Formula | C57H40GeN4OPt-2 |
| Molecular Weight | 1069.69 g/mol |
| Exact Mass | 1070.24 |
| IUPAC Name | — |
| SMILES | [2H]c1c([2H])c([2H])c(-c2cccc3c2-[n+]2[c-]n(-c4[c-]c(Oc5[c-]c6c(cc5)c5ccccc5n6-c5cc([Ge](C)(C)C)ccn5)ccc4)c4cccc(c42)-c2ccccc2-c2ccccc2-3)c([2H])c1[2H].[Pt] |
| InChI | InChI=1S/C57H40GeN4O.Pt/c1-58(2,3)39-32-33-59-55(34-39)62-52-28-12-11-24-48(52)49-31-30-42(36-54(49)62)63-41-19-13-18-40(35-41)60-37-61-56-43(38-16-5-4-6-17-38)25-14-26-50(56)46-22-9-7-20-44(46)45-21-8-10-23-47(45)51-27-15-29-53(60)57(51)61;/h4-34H,1-3H3;/q-2;/i4D,5D,6D,16D,17D; |
| InChIKey | JQFJBDALWHXLPU-YBHQIQAZSA-N |
| XLogP | 13.12 |
| TPSA | 35.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1069.69 |
| LogP ≤ 5 | 13.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|