C72H64N6 — CID 168743816
2,3,4,6-tetrakis(3,6-diethylcarbazol-9-yl)-5-isocyanobenzonitrile (PubChem CID 168743816) has the molecular formula C72H64N6 and a molecular weight of 1013.35 g/mol. Its IUPAC name is 2,3,4,6-tetrakis(3,6-diethylcarbazol-9-yl)-5-isocyanobenzonitrile.
| Compound Name | 2,3,4,6-tetrakis(3,6-diethylcarbazol-9-yl)-5-isocyanobenzonitrile |
|---|---|
| PubChem CID | 168743816 |
| Molecular Formula | C72H64N6 |
| Molecular Weight | 1013.35 g/mol |
| Exact Mass | 1012.52 |
| IUPAC Name | 2,3,4,6-tetrakis(3,6-diethylcarbazol-9-yl)-5-isocyanobenzonitrile |
| SMILES | [C-]#[N+]c1c(-n2c3ccc(CC)cc3c3cc(CC)ccc32)c(C#N)c(-n2c3ccc(CC)cc3c3cc(CC)ccc32)c(-n2c3ccc(CC)cc3c3cc(CC)ccc32)c1-n1c2ccc(CC)cc2c2cc(CC)ccc21 |
| InChI | InChI=1S/C72H64N6/c1-10-43-18-26-60-51(34-43)52-35-44(11-2)19-27-61(52)75(60)69-59(42-73)70(76-62-28-20-45(12-3)36-53(62)54-37-46(13-4)21-29-63(54)76)72(78-66-32-24-49(16-7)40-57(66)58-41-50(17-8)25-33-67(58)78)71(68(69)74-9)77-64-30-22-47(14-5)38-55(64)56-39-48(15-6)23-31-65(56)77/h18-41H,10-17H2,1-8H3 |
| InChIKey | WJMWLGRRNKTBOJ-UHFFFAOYSA-N |
| XLogP | 19.00 |
| TPSA | 47.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.35 |
| LogP ≤ 5 | 19.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|