About 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine
2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine (PubChem CID 168745074) has the molecular formula C20H17N
and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine.
Molecular Properties
| Compound Name | 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine |
| PubChem CID | 168745074 |
| Molecular Formula | C20H17N |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine |
| SMILES | Cc1ccc2c(c1)C(C)c1cc(-c3ccccn3)ccc1-2 |
| InChI | InChI=1S/C20H17N/c1-13-6-8-16-17-9-7-15(20-5-3-4-10-21-20)12-19(17)14(2)18(16)11-13/h3-12,14H,1-2H3 |
| InChIKey | CCWKDIVNMHWFGE-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine?
The IUPAC name of 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine (CID 168745074) is 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine.
What is the SMILES notation for 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine?
The canonical SMILES for 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine is Cc1ccc2c(c1)C(C)c1cc(-c3ccccn3)ccc1-2.
What is the InChIKey of 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine?
The InChIKey is CCWKDIVNMHWFGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N/c1-13-6-8-16-17-9-7-15(20-5-3-4-10-21-20)12-19(17)14(2)18(16)11-13/h3-12,14H,1-2H3.
What are the key properties of 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine?
2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine has a molecular weight of 271.36 g/mol, XLogP of 5.19, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7,9-dimethyl-9H-fluoren-2-yl)pyridine is sourced from PubChem (CID 168745074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).