C18H10N4O — CID 168746542
11-quinolin-8-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 168746542) has the molecular formula C18H10N4O and a molecular weight of 298.31 g/mol. Its IUPAC name is 11-quinolin-8-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 11-quinolin-8-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 168746542 |
| Molecular Formula | C18H10N4O |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 11-quinolin-8-yl-8-oxa-3,5,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | c1cnc2c(-c3ccc4c(n3)oc3cncnc34)cccc2c1 |
| InChI | InChI=1S/C18H10N4O/c1-3-11-4-2-8-20-16(11)12(5-1)14-7-6-13-17-15(9-19-10-21-17)23-18(13)22-14/h1-10H |
| InChIKey | UFAMZTKPJHPPLD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |