C15H13F3N4 — CID 168750318
1-(6-isocyano-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine (PubChem CID 168750318) has the molecular formula C15H13F3N4 and a molecular weight of 306.29 g/mol. Its IUPAC name is 1-(6-isocyano-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine.
| Compound Name | 1-(6-isocyano-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 168750318 |
| Molecular Formula | C15H13F3N4 |
| Molecular Weight | 306.29 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 1-(6-isocyano-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine |
| SMILES | [C-]#[N+]c1cccc(C(C)NCc2ccc(C(F)(F)F)cn2)n1 |
| InChI | InChI=1S/C15H13F3N4/c1-10(13-4-3-5-14(19-2)22-13)20-9-12-7-6-11(8-21-12)15(16,17)18/h3-8,10,20H,9H2,1H3 |
| InChIKey | COMAWMGNKJPTFJ-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 42.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.29 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|