C14H13F4N3 — CID 168750275
(1R)-1-(3-fluoro-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine (PubChem CID 168750275) has the molecular formula C14H13F4N3 and a molecular weight of 299.27 g/mol. Its IUPAC name is (1R)-1-(3-fluoro-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine.
| Compound Name | (1R)-1-(3-fluoro-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine |
|---|---|
| PubChem CID | 168750275 |
| Molecular Formula | C14H13F4N3 |
| Molecular Weight | 299.27 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (1R)-1-(3-fluoro-2-pyridinyl)-N-[[5-(trifluoromethyl)-2-pyridinyl]methyl]ethanamine |
| SMILES | C[C@@H](NCc1ccc(C(F)(F)F)cn1)c1ncccc1F |
| InChI | InChI=1S/C14H13F4N3/c1-9(13-12(15)3-2-6-19-13)20-8-11-5-4-10(7-21-11)14(16,17)18/h2-7,9,20H,8H2,1H3/t9-/m1/s1 |
| InChIKey | LQDDHBXPLZTDBK-SECBINFHSA-N |
| XLogP | 3.49 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.27 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |