C11H7F2NO3 — CID 168754201
methyl 5,7-difluoro-4-oxo-1H-quinoline-6-carboxylate (PubChem CID 168754201) has the molecular formula C11H7F2NO3 and a molecular weight of 239.18 g/mol. Its IUPAC name is methyl 5,7-difluoro-4-oxo-1H-quinoline-6-carboxylate.
| Compound Name | methyl 5,7-difluoro-4-oxo-1H-quinoline-6-carboxylate |
|---|---|
| PubChem CID | 168754201 |
| Molecular Formula | C11H7F2NO3 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | methyl 5,7-difluoro-4-oxo-1H-quinoline-6-carboxylate |
| SMILES | COC(=O)c1c(F)cc2[nH]ccc(=O)c2c1F |
| InChI | InChI=1S/C11H7F2NO3/c1-17-11(16)8-5(12)4-6-9(10(8)13)7(15)2-3-14-6/h2-4H,1H3,(H,14,15) |
| InChIKey | PBKUCQVXENTFHB-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |