C22H33N3 — CID 168756097
6-tert-butyl-1-cyclopropyl-4-(4-propan-2-ylpiperazin-1-yl)indole (PubChem CID 168756097) has the molecular formula C22H33N3 and a molecular weight of 339.53 g/mol. Its IUPAC name is 6-tert-butyl-1-cyclopropyl-4-(4-propan-2-ylpiperazin-1-yl)indole.
| Compound Name | 6-tert-butyl-1-cyclopropyl-4-(4-propan-2-ylpiperazin-1-yl)indole |
|---|---|
| PubChem CID | 168756097 |
| Molecular Formula | C22H33N3 |
| Molecular Weight | 339.53 g/mol |
| Exact Mass | 339.27 |
| IUPAC Name | 6-tert-butyl-1-cyclopropyl-4-(4-propan-2-ylpiperazin-1-yl)indole |
| SMILES | CC(C)N1CCN(c2cc(C(C)(C)C)cc3c2ccn3C2CC2)CC1 |
| InChI | InChI=1S/C22H33N3/c1-16(2)23-10-12-24(13-11-23)20-14-17(22(3,4)5)15-21-19(20)8-9-25(21)18-6-7-18/h8-9,14-16,18H,6-7,10-13H2,1-5H3 |
| InChIKey | VPCBOMTUCCJTCY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.53 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |