C15H17F2N — CID 118162022
4,6-difluoro-1-(4-methylcyclohexyl)indole (PubChem CID 118162022) has the molecular formula C15H17F2N and a molecular weight of 249.30 g/mol. Its IUPAC name is 4,6-difluoro-1-(4-methylcyclohexyl)indole.
| Compound Name | 4,6-difluoro-1-(4-methylcyclohexyl)indole |
|---|---|
| PubChem CID | 118162022 |
| Molecular Formula | C15H17F2N |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4,6-difluoro-1-(4-methylcyclohexyl)indole |
| SMILES | CC1CCC(n2ccc3c(F)cc(F)cc32)CC1 |
| InChI | InChI=1S/C15H17F2N/c1-10-2-4-12(5-3-10)18-7-6-13-14(17)8-11(16)9-15(13)18/h6-10,12H,2-5H2,1H3 |
| InChIKey | HKQZLLTWGRRMOH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |