About (4-ethylpiperidin-4-yl) 2-sulfanylacetate
(4-ethylpiperidin-4-yl) 2-sulfanylacetate (PubChem CID 168757853) has the molecular formula C9H17NO2S
and a molecular weight of 203.31 g/mol. Its IUPAC name is (4-ethylpiperidin-4-yl) 2-sulfanylacetate.
Molecular Properties
| Compound Name | (4-ethylpiperidin-4-yl) 2-sulfanylacetate |
| PubChem CID | 168757853 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | (4-ethylpiperidin-4-yl) 2-sulfanylacetate |
| SMILES | CCC1(OC(=O)CS)CCNCC1 |
| InChI | InChI=1S/C9H17NO2S/c1-2-9(12-8(11)7-13)3-5-10-6-4-9/h10,13H,2-7H2,1H3 |
| InChIKey | MEKLCCMVGYPCPJ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylpiperidin-4-yl) 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylpiperidin-4-yl) 2-sulfanylacetate?
The IUPAC name of (4-ethylpiperidin-4-yl) 2-sulfanylacetate (CID 168757853) is (4-ethylpiperidin-4-yl) 2-sulfanylacetate.
What is the SMILES notation for (4-ethylpiperidin-4-yl) 2-sulfanylacetate?
The canonical SMILES for (4-ethylpiperidin-4-yl) 2-sulfanylacetate is CCC1(OC(=O)CS)CCNCC1.
What is the InChIKey of (4-ethylpiperidin-4-yl) 2-sulfanylacetate?
The InChIKey is MEKLCCMVGYPCPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO2S/c1-2-9(12-8(11)7-13)3-5-10-6-4-9/h10,13H,2-7H2,1H3.
What are the key properties of (4-ethylpiperidin-4-yl) 2-sulfanylacetate?
(4-ethylpiperidin-4-yl) 2-sulfanylacetate has a molecular weight of 203.31 g/mol, XLogP of 0.99, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylpiperidin-4-yl) 2-sulfanylacetate is sourced from PubChem (CID 168757853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).