About (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate
(3-ethylpyrrolidin-3-yl) 2-sulfanylacetate (PubChem CID 168758060) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate.
Molecular Properties
| Compound Name | (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate |
| PubChem CID | 168758060 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate |
| SMILES | CCC1(OC(=O)CS)CCNC1 |
| InChI | InChI=1S/C8H15NO2S/c1-2-8(3-4-9-6-8)11-7(10)5-12/h9,12H,2-6H2,1H3 |
| InChIKey | UQWHUFDBLPQRRF-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate?
The IUPAC name of (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate (CID 168758060) is (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate.
What is the SMILES notation for (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate?
The canonical SMILES for (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate is CCC1(OC(=O)CS)CCNC1.
What is the InChIKey of (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate?
The InChIKey is UQWHUFDBLPQRRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-2-8(3-4-9-6-8)11-7(10)5-12/h9,12H,2-6H2,1H3.
What are the key properties of (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate?
(3-ethylpyrrolidin-3-yl) 2-sulfanylacetate has a molecular weight of 189.28 g/mol, XLogP of 0.60, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethylpyrrolidin-3-yl) 2-sulfanylacetate is sourced from PubChem (CID 168758060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).