C10H20NO2S+ — CID 168758117
(1,4-dimethylpiperidin-1-ium-4-yl) 2-sulfanylpropanoate (PubChem CID 168758117) has the molecular formula C10H20NO2S+ and a molecular weight of 218.34 g/mol. Its IUPAC name is (1,4-dimethylpiperidin-1-ium-4-yl) 2-sulfanylpropanoate.
| Compound Name | (1,4-dimethylpiperidin-1-ium-4-yl) 2-sulfanylpropanoate |
|---|---|
| PubChem CID | 168758117 |
| Molecular Formula | C10H20NO2S+ |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | (1,4-dimethylpiperidin-1-ium-4-yl) 2-sulfanylpropanoate |
| SMILES | CC(S)C(=O)OC1(C)CC[NH+](C)CC1 |
| InChI | InChI=1S/C10H19NO2S/c1-8(14)9(12)13-10(2)4-6-11(3)7-5-10/h8,14H,4-7H2,1-3H3/p+1 |
| InChIKey | IXTLERBDYKNWGW-UHFFFAOYSA-O |
| XLogP | -0.08 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|