C15H8F4O — CID 168762994
(2R)-2-(3,4-difluorophenyl)-5,7-difluoro-2H-chromene (PubChem CID 168762994) has the molecular formula C15H8F4O and a molecular weight of 280.22 g/mol. Its IUPAC name is (2R)-2-(3,4-difluorophenyl)-5,7-difluoro-2H-chromene.
| Compound Name | (2R)-2-(3,4-difluorophenyl)-5,7-difluoro-2H-chromene |
|---|---|
| PubChem CID | 168762994 |
| Molecular Formula | C15H8F4O |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | (2R)-2-(3,4-difluorophenyl)-5,7-difluoro-2H-chromene |
| SMILES | Fc1cc(F)c2c(c1)O[C@@H](c1ccc(F)c(F)c1)C=C2 |
| InChI | InChI=1S/C15H8F4O/c16-9-6-12(18)10-2-4-14(20-15(10)7-9)8-1-3-11(17)13(19)5-8/h1-7,14H/t14-/m1/s1 |
| InChIKey | LMCPJIXTYBHGCO-CQSZACIVSA-N |
| XLogP | 4.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |