C11H8F2O3 — CID 146228532
1-(5,7-difluoro-2-hydroxy-2H-chromen-3-yl)ethanone (PubChem CID 146228532) has the molecular formula C11H8F2O3 and a molecular weight of 226.18 g/mol. Its IUPAC name is 1-(5,7-difluoro-2-hydroxy-2H-chromen-3-yl)ethanone.
| Compound Name | 1-(5,7-difluoro-2-hydroxy-2H-chromen-3-yl)ethanone |
|---|---|
| PubChem CID | 146228532 |
| Molecular Formula | C11H8F2O3 |
| Molecular Weight | 226.18 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 1-(5,7-difluoro-2-hydroxy-2H-chromen-3-yl)ethanone |
| SMILES | CC(=O)C1=Cc2c(F)cc(F)cc2OC1O |
| InChI | InChI=1S/C11H8F2O3/c1-5(14)7-4-8-9(13)2-6(12)3-10(8)16-11(7)15/h2-4,11,15H,1H3 |
| InChIKey | RTFIBQOWXNZQAH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.18 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |