C16H10ClF3O2 — CID 86053587
1-(4-chlorophenyl)-2-(2,4,6-trifluorophenyl)butane-1,3-dione (PubChem CID 86053587) has the molecular formula C16H10ClF3O2 and a molecular weight of 326.70 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-2-(2,4,6-trifluorophenyl)butane-1,3-dione.
| Compound Name | 1-(4-chlorophenyl)-2-(2,4,6-trifluorophenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 86053587 |
| Molecular Formula | C16H10ClF3O2 |
| Molecular Weight | 326.70 g/mol |
| Exact Mass | 326.03 |
| IUPAC Name | 1-(4-chlorophenyl)-2-(2,4,6-trifluorophenyl)butane-1,3-dione |
| SMILES | CC(=O)C(C(=O)c1ccc(Cl)cc1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C16H10ClF3O2/c1-8(21)14(15-12(19)6-11(18)7-13(15)20)16(22)9-2-4-10(17)5-3-9/h2-7,14H,1H3 |
| InChIKey | DIIMDTBSZHRSPB-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.70 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|