C12H16N2O7S — CID 168763802
(2S)-2-[[(2S)-2-amino-3-(3-hydroxy-4-sulfinooxyphenyl)propanoyl]amino]propanoic acid (PubChem CID 168763802) has the molecular formula C12H16N2O7S and a molecular weight of 332.33 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-amino-3-(3-hydroxy-4-sulfinooxyphenyl)propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-amino-3-(3-hydroxy-4-sulfinooxyphenyl)propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 168763802 |
| Molecular Formula | C12H16N2O7S |
| Molecular Weight | 332.33 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | (2S)-2-[[(2S)-2-amino-3-(3-hydroxy-4-sulfinooxyphenyl)propanoyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccc(OS(=O)O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C12H16N2O7S/c1-6(12(17)18)14-11(16)8(13)4-7-2-3-10(9(15)5-7)21-22(19)20/h2-3,5-6,8,15H,4,13H2,1H3,(H,14,16)(H,17,18)(H,19,20)/t6-,8-/m0/s1 |
| InChIKey | HSAUDSKWDSTJJD-XPUUQOCRSA-N |
| XLogP | -0.63 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.33 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|