C40H25N3OS — CID 168770311
2-(dibenzothiophen-4-ylmethyl)-4-[8-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine (PubChem CID 168770311) has the molecular formula C40H25N3OS and a molecular weight of 600.76 g/mol. Its IUPAC name is 2-(dibenzothiophen-4-ylmethyl)-4-[8-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-(dibenzothiophen-4-ylmethyl)-4-[8-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 168770311 |
| Molecular Formula | C40H25N3OS |
| Molecular Weight | 600.76 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 2-(dibenzothiophen-4-ylmethyl)-4-[8-(2,3,4,5,6-pentadeuteriophenyl)dibenzofuran-1-yl]-6-phenyl-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ccc3oc4cccc(-c5nc(Cc6cccc7c6sc6ccccc67)nc(-c6ccccc6)n5)c4c3c2)c([2H])c1[2H] |
| InChI | InChI=1S/C40H25N3OS/c1-3-11-25(12-4-1)27-21-22-33-32(23-27)37-31(18-10-19-34(37)44-33)40-42-36(41-39(43-40)26-13-5-2-6-14-26)24-28-15-9-17-30-29-16-7-8-20-35(29)45-38(28)30/h1-23H,24H2/i1D,3D,4D,11D,12D |
| InChIKey | CCHSVBBXIHVHIH-KTRFVSTQSA-N |
| XLogP | 10.73 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.76 |
| LogP ≤ 5 | 10.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |