C21H31NO3 — CID 168787841
tert-butyl 3-methyl-3-(4-pentan-3-ylbenzoyl)azetidine-1-carboxylate (PubChem CID 168787841) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is tert-butyl 3-methyl-3-(4-pentan-3-ylbenzoyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-methyl-3-(4-pentan-3-ylbenzoyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 168787841 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | tert-butyl 3-methyl-3-(4-pentan-3-ylbenzoyl)azetidine-1-carboxylate |
| SMILES | CCC(CC)c1ccc(C(=O)C2(C)CN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C21H31NO3/c1-7-15(8-2)16-9-11-17(12-10-16)18(23)21(6)13-22(14-21)19(24)25-20(3,4)5/h9-12,15H,7-8,13-14H2,1-6H3 |
| InChIKey | ZUZCGBNOLCNHSP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |