About 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol
1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol (PubChem CID 168788254) has the molecular formula C7H10N2O2
and a molecular weight of 154.17 g/mol. Its IUPAC name is 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol.
Analyze 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol?
The IUPAC name of 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol (CID 168788254) is 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol.
What is the SMILES notation for 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol?
The canonical SMILES for 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol is Cc1nc(C2(O)CC2)c(N)o1.
What is the InChIKey of 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol?
The InChIKey is DFTAICGQZYKRHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2/c1-4-9-5(6(8)11-4)7(10)2-3-7/h10H,2-3,8H2,1H3.
What are the key properties of 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol?
1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol has a molecular weight of 154.17 g/mol, XLogP of 0.55, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(5-amino-2-methyl-1,3-oxazol-4-yl)cyclopropan-1-ol is sourced from PubChem (CID 168788254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).