C29H27N5OPt — CID 168793706
3-(4-tert-butylbenzene-6-id-1-yl)-6-methoxypyridazine;2-(3-phenylpyrazol-1-id-5-yl)pyridine;platinum(2+) (PubChem CID 168793706) has the molecular formula C29H27N5OPt and a molecular weight of 656.65 g/mol. Its IUPAC name is 3-(4-tert-butylbenzene-6-id-1-yl)-6-methoxypyridazine;2-(3-phenylpyrazol-1-id-5-yl)pyridine;platinum(2+).
| Compound Name | 3-(4-tert-butylbenzene-6-id-1-yl)-6-methoxypyridazine;2-(3-phenylpyrazol-1-id-5-yl)pyridine;platinum(2+) |
|---|---|
| PubChem CID | 168793706 |
| Molecular Formula | C29H27N5OPt |
| Molecular Weight | 656.65 g/mol |
| Exact Mass | 656.19 |
| IUPAC Name | 3-(4-tert-butylbenzene-6-id-1-yl)-6-methoxypyridazine;2-(3-phenylpyrazol-1-id-5-yl)pyridine;platinum(2+) |
| SMILES | COc1ccc(-c2[c-]cc(C(C)(C)C)cc2)nn1.[Pt+2].c1ccc(-c2cc(-c3ccccn3)[n-]n2)cc1 |
| InChI | InChI=1S/C15H17N2O.C14H10N3.Pt/c1-15(2,3)12-7-5-11(6-8-12)13-9-10-14(18-4)17-16-13;1-2-6-11(7-3-1)13-10-14(17-16-13)12-8-4-5-9-15-12;/h5,7-10H,1-4H3;1-10H;/q2*-1;+2 |
| InChIKey | SCNDTZHSWPCTDF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 74.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.65 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|