C20H14F3N5OPt — CID 168793709
3-methoxy-6-phenylpyridazine;platinum(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 168793709) has the molecular formula C20H14F3N5OPt and a molecular weight of 592.44 g/mol. Its IUPAC name is 3-methoxy-6-phenylpyridazine;platinum(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 3-methoxy-6-phenylpyridazine;platinum(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 168793709 |
| Molecular Formula | C20H14F3N5OPt |
| Molecular Weight | 592.44 g/mol |
| Exact Mass | 592.08 |
| IUPAC Name | 3-methoxy-6-phenylpyridazine;platinum(2+);2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | COc1ccc(-c2[c-]cccc2)nn1.FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[Pt+2] |
| InChI | InChI=1S/C11H9N2O.C9H5F3N3.Pt/c1-14-11-8-7-10(12-13-11)9-5-3-2-4-6-9;10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h2-5,7-8H,1H3;1-5H;/q2*-1;+2 |
| InChIKey | CXUNKDWZWQRKRV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 74.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|