C21H14F4IrN4O-2 — CID 20807381
2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine (PubChem CID 20807381) has the molecular formula C21H14F4IrN4O-2 and a molecular weight of 606.58 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
|---|---|
| PubChem CID | 20807381 |
| Molecular Formula | C21H14F4IrN4O-2 |
| Molecular Weight | 606.58 g/mol |
| Exact Mass | 607.07 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;2-[3-(trifluoromethyl)pyrazol-1-id-5-yl]pyridine |
| SMILES | COc1ccnc(-c2[c-]cc(F)cc2)c1.FC(F)(F)c1cc(-c2ccccn2)[n-]n1.[Ir] |
| InChI | InChI=1S/C12H9FNO.C9H5F3N3.Ir/c1-15-11-6-7-14-12(8-11)9-2-4-10(13)5-3-9;10-9(11,12)8-5-7(14-15-8)6-3-1-2-4-13-6;/h2,4-8H,1H3;1-5H;/q2*-1; |
| InChIKey | AZCFYDGWZWIOGW-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 62.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.58 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|