C20H15F4IrN3O2-2 — CID 20807379
2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide (PubChem CID 20807379) has the molecular formula C20H15F4IrN3O2-2 and a molecular weight of 597.57 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide |
|---|---|
| PubChem CID | 20807379 |
| Molecular Formula | C20H15F4IrN3O2-2 |
| Molecular Weight | 597.57 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl-(2,2,2-trifluoroacetyl)azanide |
| SMILES | COc1ccnc(-c2[c-]cc(F)cc2)c1.O=C([N-]Cc1ccccn1)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C12H9FNO.C8H7F3N2O.Ir/c1-15-11-6-7-14-12(8-11)9-2-4-10(13)5-3-9;9-8(10,11)7(14)13-5-6-3-1-2-4-12-6;/h2,4-8H,1H3;1-4H,5H2,(H,13,14);/q-1;;/p-1 |
| InChIKey | IYSZHTFEDRNFOW-UHFFFAOYSA-M |
| XLogP | 4.74 |
| TPSA | 66.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|