C19H14ClF3N2O2Pt — CID 21024872
chloroplatinum(1+);4-methoxy-2-[3-(4-methoxy-2-pyridinyl)-5-(trifluoromethyl)benzene-2-id-1-yl]pyridine (PubChem CID 21024872) has the molecular formula C19H14ClF3N2O2Pt and a molecular weight of 589.86 g/mol. Its IUPAC name is chloroplatinum(1+);4-methoxy-2-[3-(4-methoxy-2-pyridinyl)-5-(trifluoromethyl)benzene-2-id-1-yl]pyridine.
| Compound Name | chloroplatinum(1+);4-methoxy-2-[3-(4-methoxy-2-pyridinyl)-5-(trifluoromethyl)benzene-2-id-1-yl]pyridine |
|---|---|
| PubChem CID | 21024872 |
| Molecular Formula | C19H14ClF3N2O2Pt |
| Molecular Weight | 589.86 g/mol |
| Exact Mass | 589.03 |
| IUPAC Name | chloroplatinum(1+);4-methoxy-2-[3-(4-methoxy-2-pyridinyl)-5-(trifluoromethyl)benzene-2-id-1-yl]pyridine |
| SMILES | COc1ccnc(-c2[c-]c(-c3cc(OC)ccn3)cc(C(F)(F)F)c2)c1.Cl[Pt+] |
| InChI | InChI=1S/C19H14F3N2O2.ClH.Pt/c1-25-15-3-5-23-17(10-15)12-7-13(9-14(8-12)19(20,21)22)18-11-16(26-2)4-6-24-18;;/h3-6,8-11H,1-2H3;1H;/q-1;;+2/p-1 |
| InChIKey | WYMTYVVALJCJAW-UHFFFAOYSA-M |
| XLogP | 5.33 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.86 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|