C19H15F4IrN3O3S-2 — CID 20807380
2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide (PubChem CID 20807380) has the molecular formula C19H15F4IrN3O3S-2 and a molecular weight of 633.62 g/mol. Its IUPAC name is 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide.
| Compound Name | 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide |
|---|---|
| PubChem CID | 20807380 |
| Molecular Formula | C19H15F4IrN3O3S-2 |
| Molecular Weight | 633.62 g/mol |
| Exact Mass | 634.04 |
| IUPAC Name | 2-(4-fluorobenzene-6-id-1-yl)-4-methoxypyridine;iridium;pyridin-2-ylmethyl(trifluoromethylsulfonyl)azanide |
| SMILES | COc1ccnc(-c2[c-]cc(F)cc2)c1.O=S(=O)([N-]Cc1ccccn1)C(F)(F)F.[Ir] |
| InChI | InChI=1S/C12H9FNO.C7H6F3N2O2S.Ir/c1-15-11-6-7-14-12(8-11)9-2-4-10(13)5-3-9;8-7(9,10)15(13,14)12-5-6-3-1-2-4-11-6;/h2,4-8H,1H3;1-4H,5H2;/q2*-1; |
| InChIKey | PHUWCQJGJNGTLL-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 83.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.62 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|